About (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid
(3-oxo-1,2-oxazol-5-yl)methylcarbamic acid (PubChem CID 174238438) has the molecular formula C5H6N2O4
and a molecular weight of 158.11 g/mol. Its IUPAC name is (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid.
Molecular Properties
| Compound Name | (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid |
| PubChem CID | 174238438 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid |
| SMILES | O=C(O)NCc1cc(=O)[nH]o1 |
| InChI | InChI=1S/C5H6N2O4/c8-4-1-3(11-7-4)2-6-5(9)10/h1,6H,2H2,(H,7,8)(H,9,10) |
| InChIKey | JIVPKSBMKBFUNZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid?
The IUPAC name of (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid (CID 174238438) is (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid.
What is the SMILES notation for (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid?
The canonical SMILES for (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid is O=C(O)NCc1cc(=O)[nH]o1.
What is the InChIKey of (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid?
The InChIKey is JIVPKSBMKBFUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c8-4-1-3(11-7-4)2-6-5(9)10/h1,6H,2H2,(H,7,8)(H,9,10).
What are the key properties of (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid?
(3-oxo-1,2-oxazol-5-yl)methylcarbamic acid has a molecular weight of 158.11 g/mol, XLogP of -0.26, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-1,2-oxazol-5-yl)methylcarbamic acid is sourced from PubChem (CID 174238438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).