About 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide
5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 174238445) has the molecular formula C7H8F3N3O
and a molecular weight of 207.16 g/mol. Its IUPAC name is 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide |
| PubChem CID | 174238445 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(c1cc(C(N)=O)n[nH]1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O/c1-3(7(8,9)10)4-2-5(6(11)14)13-12-4/h2-3H,1H3,(H2,11,14)(H,12,13) |
| InChIKey | UNSFFICAKHVINV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide (CID 174238445) is 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide is CC(c1cc(C(N)=O)n[nH]1)C(F)(F)F.
What is the InChIKey of 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide?
The InChIKey is UNSFFICAKHVINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c1-3(7(8,9)10)4-2-5(6(11)14)13-12-4/h2-3H,1H3,(H2,11,14)(H,12,13).
What are the key properties of 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide?
5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide has a molecular weight of 207.16 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1,1-trifluoropropan-2-yl)-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 174238445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).