C24H26FNO5 — CID 174238471
(2S,3S,4S,5R)-4-[3-[(4-cyclopropylphenyl)methyl]-4-fluoroindol-1-yl]-2-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 174238471) has the molecular formula C24H26FNO5 and a molecular weight of 427.47 g/mol. Its IUPAC name is (2S,3S,4S,5R)-4-[3-[(4-cyclopropylphenyl)methyl]-4-fluoroindol-1-yl]-2-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R)-4-[3-[(4-cyclopropylphenyl)methyl]-4-fluoroindol-1-yl]-2-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 174238471 |
| Molecular Formula | C24H26FNO5 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2S,3S,4S,5R)-4-[3-[(4-cyclopropylphenyl)methyl]-4-fluoroindol-1-yl]-2-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1OC[C@@H](O)[C@@](O)(n2cc(Cc3ccc(C4CC4)cc3)c3c(F)cccc32)[C@H]1O |
| InChI | InChI=1S/C24H26FNO5/c25-18-2-1-3-19-22(18)17(10-14-4-6-15(7-5-14)16-8-9-16)11-26(19)24(30)21(28)13-31-20(12-27)23(24)29/h1-7,11,16,20-21,23,27-30H,8-10,12-13H2/t20-,21+,23-,24-/m0/s1 |
| InChIKey | XMQDWARTUYFDQH-DVKRWUGUSA-N |
| XLogP | 2.01 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |