C18H16N2O3S — CID 174239538
5-(4-ethoxyphenyl)-N-(thiophen-2-ylmethylideneamino)furan-2-carboxamide (PubChem CID 174239538) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-N-(thiophen-2-ylmethylideneamino)furan-2-carboxamide.
| Compound Name | 5-(4-ethoxyphenyl)-N-(thiophen-2-ylmethylideneamino)furan-2-carboxamide |
|---|---|
| PubChem CID | 174239538 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-(4-ethoxyphenyl)-N-(thiophen-2-ylmethylideneamino)furan-2-carboxamide |
| SMILES | CCOc1ccc(-c2ccc(C(=O)NN=Cc3cccs3)o2)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-2-22-14-7-5-13(6-8-14)16-9-10-17(23-16)18(21)20-19-12-15-4-3-11-24-15/h3-12H,2H2,1H3,(H,20,21) |
| InChIKey | VHCNXYKOGUOKSO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|