C29H27ClF5N6O3S- — CID 174239717
2-[[5-(1,1-difluoroethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine;hydrochloride (PubChem CID 174239717) has the molecular formula C29H27ClF5N6O3S- and a molecular weight of 670.08 g/mol. Its IUPAC name is 2-[[5-(1,1-difluoroethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine;hydrochloride.
| Compound Name | 2-[[5-(1,1-difluoroethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 174239717 |
| Molecular Formula | C29H27ClF5N6O3S- |
| Molecular Weight | 670.08 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | 2-[[5-(1,1-difluoroethyl)piperidin-3-yl]amino]-4-[2-[2,3,5-trifluoro-4-[phenyl-(sulfinatoamino)methyl]phenoxy]-3-pyridinyl]pyrimidine;hydrochloride |
| SMILES | CC(F)(F)C1CNCC(Nc2nccc(-c3cccnc3Oc3cc(F)c(C(NS(=O)[O-])c4ccccc4)c(F)c3F)n2)C1.Cl |
| InChI | InChI=1S/C29H27F5N6O3S.ClH/c1-29(33,34)17-12-18(15-35-14-17)38-28-37-11-9-21(39-28)19-8-5-10-36-27(19)43-22-13-20(30)23(25(32)24(22)31)26(40-44(41)42)16-6-3-2-4-7-16;/h2-11,13,17-18,26,35,40H,12,14-15H2,1H3,(H,41,42)(H,37,38,39);1H/p-1 |
| InChIKey | JKXWWYVWQUVKHZ-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|