About sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone
sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone (PubChem CID 174240121) has the molecular formula C15H17Cl2F3N2O3S
and a molecular weight of 433.28 g/mol. Its IUPAC name is sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone |
| PubChem CID | 174240121 |
| Molecular Formula | C15H17Cl2F3N2O3S |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(C2(c3ccccc3)CC2)CC1)C(F)(F)F.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C15H17F3N2O.Cl2O2S/c16-15(17,18)13(21)19-8-10-20(11-9-19)14(6-7-14)12-4-2-1-3-5-12;1-5(2,3)4/h1-5H,6-11H2; |
| InChIKey | BPVODCKKLALGLO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone?
The IUPAC name of sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone (CID 174240121) is sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone.
What is the SMILES notation for sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone?
The canonical SMILES for sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone is O=C(N1CCN(C2(c3ccccc3)CC2)CC1)C(F)(F)F.O=S(=O)(Cl)Cl.
What is the InChIKey of sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone?
The InChIKey is BPVODCKKLALGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N2O.Cl2O2S/c16-15(17,18)13(21)19-8-10-20(11-9-19)14(6-7-14)12-4-2-1-3-5-12;1-5(2,3)4/h1-5H,6-11H2;.
What are the key properties of sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone?
sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone has a molecular weight of 433.28 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuryl dichloride;2,2,2-trifluoro-1-[4-(1-phenylcyclopropyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 174240121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).