C21H18F3N3O6 — CID 174240776
2-[5-(1,3-dioxolan-2-yl)-6-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]pyrimidin-4-yl]propanedioic acid (PubChem CID 174240776) has the molecular formula C21H18F3N3O6 and a molecular weight of 465.38 g/mol. Its IUPAC name is 2-[5-(1,3-dioxolan-2-yl)-6-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]pyrimidin-4-yl]propanedioic acid.
| Compound Name | 2-[5-(1,3-dioxolan-2-yl)-6-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]pyrimidin-4-yl]propanedioic acid |
|---|---|
| PubChem CID | 174240776 |
| Molecular Formula | C21H18F3N3O6 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-[5-(1,3-dioxolan-2-yl)-6-[[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]amino]pyrimidin-4-yl]propanedioic acid |
| SMILES | C#C[C@@H](Nc1ncnc(C(C(=O)O)C(=O)O)c1C1OCCO1)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C21H18F3N3O6/c1-3-13(11-5-4-6-12(10(11)2)21(22,23)24)27-17-14(20-32-7-8-33-20)16(25-9-26-17)15(18(28)29)19(30)31/h1,4-6,9,13,15,20H,7-8H2,2H3,(H,28,29)(H,30,31)(H,25,26,27)/t13-/m1/s1 |
| InChIKey | CAXGJHBBUKLCNK-CYBMUJFWSA-N |
| XLogP | 2.89 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|