C18H22F4N5O2S+ — CID 174241478
N-(2-aminosulfanyl-1-hydroxypyridin-1-ium-4-yl)-3-(1,1-difluoroethyl)-1-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-methylpyrazole-5-carboxamide (PubChem CID 174241478) has the molecular formula C18H22F4N5O2S+ and a molecular weight of 448.47 g/mol. Its IUPAC name is N-(2-aminosulfanyl-1-hydroxypyridin-1-ium-4-yl)-3-(1,1-difluoroethyl)-1-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-methylpyrazole-5-carboxamide.
| Compound Name | N-(2-aminosulfanyl-1-hydroxypyridin-1-ium-4-yl)-3-(1,1-difluoroethyl)-1-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174241478 |
| Molecular Formula | C18H22F4N5O2S+ |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(2-aminosulfanyl-1-hydroxypyridin-1-ium-4-yl)-3-(1,1-difluoroethyl)-1-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-methylpyrazole-5-carboxamide |
| SMILES | Cc1c(C(C)(F)F)nn(CC2(C)CC(F)(F)C2)c1C(=O)Nc1cc[n+](O)c(SN)c1 |
| InChI | InChI=1S/C18H21F4N5O2S/c1-10-13(15(28)24-11-4-5-27(29)12(6-11)30-23)26(25-14(10)17(3,19)20)9-16(2)7-18(21,22)8-16/h4-6,29H,7-9,23H2,1-3H3/p+1 |
| InChIKey | KOPGVSPBFCDCAW-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|