C25H29F3N6O4 — CID 174241783
N-[1-[(5R,8S)-8-cyano-4-oxo-2-phenyl-1,3,7-triazaspiro[4.4]non-1-en-7-yl]-4-methyl-1-oxopentan-2-yl]-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 174241783) has the molecular formula C25H29F3N6O4 and a molecular weight of 534.54 g/mol. Its IUPAC name is N-[1-[(5R,8S)-8-cyano-4-oxo-2-phenyl-1,3,7-triazaspiro[4.4]non-1-en-7-yl]-4-methyl-1-oxopentan-2-yl]-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | N-[1-[(5R,8S)-8-cyano-4-oxo-2-phenyl-1,3,7-triazaspiro[4.4]non-1-en-7-yl]-4-methyl-1-oxopentan-2-yl]-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 174241783 |
| Molecular Formula | C25H29F3N6O4 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | N-[1-[(5R,8S)-8-cyano-4-oxo-2-phenyl-1,3,7-triazaspiro[4.4]non-1-en-7-yl]-4-methyl-1-oxopentan-2-yl]-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | CC(C)CC(C(=O)N1C[C@@]2(C[C@H]1C#N)N=C(c1ccccc1)NC2=O)N(C)C(=O)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H29F3N6O4/c1-14(2)10-18(33(4)20(35)15(3)30-23(38)25(26,27)28)21(36)34-13-24(11-17(34)12-29)22(37)31-19(32-24)16-8-6-5-7-9-16/h5-9,14-15,17-18H,10-11,13H2,1-4H3,(H,30,38)(H,31,32,37)/t15?,17-,18?,24+/m0/s1 |
| InChIKey | OTFULALLHRMXMT-PFELUTMMSA-N |
| XLogP | 1.37 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |