C18H22Cl2F2N4O — CID 174242881
2-[[4-chloro-6-[2-(4-chloro-2,3-difluorophenyl)propyl]-1,3,5-triazin-2-yl]amino]-4-methylpentan-1-ol (PubChem CID 174242881) has the molecular formula C18H22Cl2F2N4O and a molecular weight of 419.30 g/mol. Its IUPAC name is 2-[[4-chloro-6-[2-(4-chloro-2,3-difluorophenyl)propyl]-1,3,5-triazin-2-yl]amino]-4-methylpentan-1-ol.
| Compound Name | 2-[[4-chloro-6-[2-(4-chloro-2,3-difluorophenyl)propyl]-1,3,5-triazin-2-yl]amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 174242881 |
| Molecular Formula | C18H22Cl2F2N4O |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-[[4-chloro-6-[2-(4-chloro-2,3-difluorophenyl)propyl]-1,3,5-triazin-2-yl]amino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1nc(Cl)nc(CC(C)c2ccc(Cl)c(F)c2F)n1 |
| InChI | InChI=1S/C18H22Cl2F2N4O/c1-9(2)6-11(8-27)23-18-25-14(24-17(20)26-18)7-10(3)12-4-5-13(19)16(22)15(12)21/h4-5,9-11,27H,6-8H2,1-3H3,(H,23,24,25,26) |
| InChIKey | VTXLNKTUJVQBEK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|