C10H13IN6O4 — CID 174242964
6-amino-5-iodo-3-methyl-1H-pyrimidine-2,4-dione;6-amino-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 174242964) has the molecular formula C10H13IN6O4 and a molecular weight of 408.16 g/mol. Its IUPAC name is 6-amino-5-iodo-3-methyl-1H-pyrimidine-2,4-dione;6-amino-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-iodo-3-methyl-1H-pyrimidine-2,4-dione;6-amino-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174242964 |
| Molecular Formula | C10H13IN6O4 |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 6-amino-5-iodo-3-methyl-1H-pyrimidine-2,4-dione;6-amino-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(N)c(I)c1=O.Cn1c(=O)cc(N)[nH]c1=O |
| InChI | InChI=1S/C5H6IN3O2.C5H7N3O2/c1-9-4(10)2(6)3(7)8-5(9)11;1-8-4(9)2-3(6)7-5(8)10/h7H2,1H3,(H,8,11);2H,6H2,1H3,(H,7,10) |
| InChIKey | CPABPCQFPKXMGQ-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|