About (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol
(3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol (PubChem CID 174243070) has the molecular formula C8H14F2O2
and a molecular weight of 180.19 g/mol. Its IUPAC name is (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol.
Molecular Properties
| Compound Name | (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol |
| PubChem CID | 174243070 |
| Molecular Formula | C8H14F2O2 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol |
| SMILES | CC(C)(C)[C@@H]1COC(F)(F)[C@@H]1O |
| InChI | InChI=1S/C8H14F2O2/c1-7(2,3)5-4-12-8(9,10)6(5)11/h5-6,11H,4H2,1-3H3/t5-,6-/m1/s1 |
| InChIKey | PKKJOSUTDOAITO-PHDIDXHHSA-N |
| XLogP | 1.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol?
The IUPAC name of (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol (CID 174243070) is (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol.
What is the SMILES notation for (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol?
The canonical SMILES for (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol is CC(C)(C)[C@@H]1COC(F)(F)[C@@H]1O.
What is the InChIKey of (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol?
The InChIKey is PKKJOSUTDOAITO-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H14F2O2/c1-7(2,3)5-4-12-8(9,10)6(5)11/h5-6,11H,4H2,1-3H3/t5-,6-/m1/s1.
What are the key properties of (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol?
(3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol has a molecular weight of 180.19 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-tert-butyl-2,2-difluorooxolan-3-ol is sourced from PubChem (CID 174243070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).