C19H26FN3 — CID 174243501
3-N-[(Z)-1-(2-ethenyl-3-fluorophenyl)ethylideneamino]-2-N,3-N-dimethylhepta-1,6-diene-2,3-diamine (PubChem CID 174243501) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-N-[(Z)-1-(2-ethenyl-3-fluorophenyl)ethylideneamino]-2-N,3-N-dimethylhepta-1,6-diene-2,3-diamine.
| Compound Name | 3-N-[(Z)-1-(2-ethenyl-3-fluorophenyl)ethylideneamino]-2-N,3-N-dimethylhepta-1,6-diene-2,3-diamine |
|---|---|
| PubChem CID | 174243501 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 3-N-[(Z)-1-(2-ethenyl-3-fluorophenyl)ethylideneamino]-2-N,3-N-dimethylhepta-1,6-diene-2,3-diamine |
| SMILES | C=CCCC(C(=C)NC)N(C)/N=C(/C)c1cccc(F)c1C=C |
| InChI | InChI=1S/C19H26FN3/c1-7-9-13-19(15(4)21-5)23(6)22-14(3)17-11-10-12-18(20)16(17)8-2/h7-8,10-12,19,21H,1-2,4,9,13H2,3,5-6H3/b22-14- |
| InChIKey | XFTXGVGSVXWOKE-HMAPJEAMSA-N |
| XLogP | 4.19 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|