C27H48O9P2S — CID 174243595
(1R,6R,8R,10S,15S)-17-cyclooctyl-8-cyclooctyloxy-3,12-dihydroxy-3-sulfanylidene-2,4,11,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane 12-oxide (PubChem CID 174243595) has the molecular formula C27H48O9P2S and a molecular weight of 610.69 g/mol. Its IUPAC name is (1R,6R,8R,10S,15S)-17-cyclooctyl-8-cyclooctyloxy-3,12-dihydroxy-3-sulfanylidene-2,4,11,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane 12-oxide.
| Compound Name | (1R,6R,8R,10S,15S)-17-cyclooctyl-8-cyclooctyloxy-3,12-dihydroxy-3-sulfanylidene-2,4,11,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane 12-oxide |
|---|---|
| PubChem CID | 174243595 |
| Molecular Formula | C27H48O9P2S |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | (1R,6R,8R,10S,15S)-17-cyclooctyl-8-cyclooctyloxy-3,12-dihydroxy-3-sulfanylidene-2,4,11,13,16-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane 12-oxide |
| SMILES | O=P1(O)OC[C@@H]2C[C@@H](OP(O)(=S)OC[C@H]3C[C@@H](OC4CCCCCCC4)C[C@@H]3O1)C(C1CCCCCCC1)O2 |
| InChI | InChI=1S/C27H48O9P2S/c28-37(29)31-19-24-17-26(27(34-24)20-11-7-3-1-4-8-12-20)36-38(30,39)32-18-21-15-23(16-25(21)35-37)33-22-13-9-5-2-6-10-14-22/h20-27H,1-19H2,(H,28,29)(H,30,39)/t21-,23-,24+,25+,26-,27?,38?/m1/s1 |
| InChIKey | YLMAGMQWPVRFQN-WOCQHPRFSA-N |
| XLogP | 6.55 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|