C15H26FN — CID 174243678
2-fluoro-5-(5-methyl-4-propan-2-ylhex-5-en-3-yl)-2,3,4,5-tetrahydropyridine (PubChem CID 174243678) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is 2-fluoro-5-(5-methyl-4-propan-2-ylhex-5-en-3-yl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 2-fluoro-5-(5-methyl-4-propan-2-ylhex-5-en-3-yl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 174243678 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-fluoro-5-(5-methyl-4-propan-2-ylhex-5-en-3-yl)-2,3,4,5-tetrahydropyridine |
| SMILES | C=C(C)C(C(C)C)C(CC)C1C=NC(F)CC1 |
| InChI | InChI=1S/C15H26FN/c1-6-13(15(10(2)3)11(4)5)12-7-8-14(16)17-9-12/h9,11-15H,2,6-8H2,1,3-5H3 |
| InChIKey | QDOQJCQXIQHOTO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|