About 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one
1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one (PubChem CID 174243733) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one |
| PubChem CID | 174243733 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one |
| SMILES | CC1Cc2cc(C(C)C)ccc2N(C)C1=O |
| InChI | InChI=1S/C14H19NO/c1-9(2)11-5-6-13-12(8-11)7-10(3)14(16)15(13)4/h5-6,8-10H,7H2,1-4H3 |
| InChIKey | RCYXSGLUDMEDAH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one?
The IUPAC name of 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one (CID 174243733) is 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one is CC1Cc2cc(C(C)C)ccc2N(C)C1=O.
What is the InChIKey of 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one?
The InChIKey is RCYXSGLUDMEDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-9(2)11-5-6-13-12(8-11)7-10(3)14(16)15(13)4/h5-6,8-10H,7H2,1-4H3.
What are the key properties of 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one?
1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one has a molecular weight of 217.31 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-propan-2-yl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 174243733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).