C28H24N2O2 — CID 174243860
1,3,5-trimethyl-2-(4-methylphenyl)-4,6-bis(4-nitrosophenyl)benzene (PubChem CID 174243860) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(4-methylphenyl)-4,6-bis(4-nitrosophenyl)benzene.
| Compound Name | 1,3,5-trimethyl-2-(4-methylphenyl)-4,6-bis(4-nitrosophenyl)benzene |
|---|---|
| PubChem CID | 174243860 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1,3,5-trimethyl-2-(4-methylphenyl)-4,6-bis(4-nitrosophenyl)benzene |
| SMILES | Cc1ccc(-c2c(C)c(-c3ccc(N=O)cc3)c(C)c(-c3ccc(N=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C28H24N2O2/c1-17-5-7-21(8-6-17)26-18(2)27(22-9-13-24(29-31)14-10-22)20(4)28(19(26)3)23-11-15-25(30-32)16-12-23/h5-16H,1-4H3 |
| InChIKey | SNRGWIDVYQTUAK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |