About N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide
N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide (PubChem CID 174243972) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide.
Molecular Properties
| Compound Name | N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide |
| PubChem CID | 174243972 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide |
| SMILES | O=C(Nc1cc(O[C@H]2CC[C@@H](CO)C2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O3/c21-10-12-6-7-14(8-12)23-16-9-15(18-11-19-16)20-17(22)13-4-2-1-3-5-13/h1-5,9,11-12,14,21H,6-8,10H2,(H,18,19,20,22)/t12-,14+/m1/s1 |
| InChIKey | LOLZZNJTSPHVJL-OCCSQVGLSA-N |
| XLogP | 2.27 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide?
The IUPAC name of N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide (CID 174243972) is N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide.
What is the SMILES notation for N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide?
The canonical SMILES for N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide is O=C(Nc1cc(O[C@H]2CC[C@@H](CO)C2)ncn1)c1ccccc1.
What is the InChIKey of N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide?
The InChIKey is LOLZZNJTSPHVJL-OCCSQVGLSA-N. The full InChI is InChI=1S/C17H19N3O3/c21-10-12-6-7-14(8-12)23-16-9-15(18-11-19-16)20-17(22)13-4-2-1-3-5-13/h1-5,9,11-12,14,21H,6-8,10H2,(H,18,19,20,22)/t12-,14+/m1/s1.
What are the key properties of N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide?
N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide has a molecular weight of 313.36 g/mol, XLogP of 2.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(1S,3R)-3-(hydroxymethyl)cyclopentyl]oxypyrimidin-4-yl]benzamide is sourced from PubChem (CID 174243972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).