C13H18N3O6P2S+ — CID 174244025
[(1S,2R,4R)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-pyrimidin-4-yloxycyclopentyl]-hydroxy-oxophosphanium (PubChem CID 174244025) has the molecular formula C13H18N3O6P2S+ and a molecular weight of 406.32 g/mol. Its IUPAC name is [(1S,2R,4R)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-pyrimidin-4-yloxycyclopentyl]-hydroxy-oxophosphanium.
| Compound Name | [(1S,2R,4R)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-pyrimidin-4-yloxycyclopentyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174244025 |
| Molecular Formula | C13H18N3O6P2S+ |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [(1S,2R,4R)-2-[[2-cyanoethoxy(hydroxy)phosphinothioyl]oxymethyl]-4-pyrimidin-4-yloxycyclopentyl]-hydroxy-oxophosphanium |
| SMILES | N#CCCOP(O)(=S)OC[C@H]1C[C@@H](Oc2ccncn2)C[C@@H]1[P+](=O)O |
| InChI | InChI=1S/C13H17N3O6P2S/c14-3-1-5-20-24(19,25)21-8-10-6-11(7-12(10)23(17)18)22-13-2-4-15-9-16-13/h2,4,9-12H,1,5-8H2,(H-,17,18,19,25)/p+1/t10-,11-,12+,24?/m1/s1 |
| InChIKey | OPADHVJCMNWJMU-JFYGWQJBSA-O |
| XLogP | 1.90 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|