C26H23N4O3+ — CID 174244222
2-[(3-amino-4-hydroxyphenyl)methyl]-8-benzyl-6-(4-hydroxyphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 174244222) has the molecular formula C26H23N4O3+ and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-[(3-amino-4-hydroxyphenyl)methyl]-8-benzyl-6-(4-hydroxyphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 2-[(3-amino-4-hydroxyphenyl)methyl]-8-benzyl-6-(4-hydroxyphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 174244222 |
| Molecular Formula | C26H23N4O3+ |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[(3-amino-4-hydroxyphenyl)methyl]-8-benzyl-6-(4-hydroxyphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | Nc1cc(CC2Nc3c(Cc4ccccc4)nc(-c4ccc(O)cc4)c[n+]3C2=O)ccc1O |
| InChI | InChI=1S/C26H22N4O3/c27-20-12-17(6-11-24(20)32)14-22-26(33)30-15-23(18-7-9-19(31)10-8-18)28-21(25(30)29-22)13-16-4-2-1-3-5-16/h1-12,15,22H,13-14H2,(H4,27,28,29,31,32)/p+1 |
| InChIKey | SXEVOCALJVVWJZ-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|