C11H23NO — CID 174244499
(4R,5S,6S)-4-methoxy-5,6-dimethyloctan-2-imine (PubChem CID 174244499) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is (4R,5S,6S)-4-methoxy-5,6-dimethyloctan-2-imine.
| Compound Name | (4R,5S,6S)-4-methoxy-5,6-dimethyloctan-2-imine |
|---|---|
| PubChem CID | 174244499 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (4R,5S,6S)-4-methoxy-5,6-dimethyloctan-2-imine |
| SMILES | [H]/N=C(\C)C[C@@H](OC)[C@@H](C)[C@@H](C)CC |
| InChI | InChI=1S/C11H23NO/c1-6-8(2)10(4)11(13-5)7-9(3)12/h8,10-12H,6-7H2,1-5H3/b12-9+/t8-,10-,11+/m0/s1 |
| InChIKey | ZDYZMQVSBPSUIM-KIRIEESXSA-N |
| XLogP | 3.11 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|