C10H14FN3O4P+ — CID 174244812
[(2R,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium (PubChem CID 174244812) has the molecular formula C10H14FN3O4P+ and a molecular weight of 290.21 g/mol. Its IUPAC name is [(2R,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174244812 |
| Molecular Formula | C10H14FN3O4P+ |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [(2R,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(pyrimidin-4-ylamino)cyclopentyl]oxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OC1[C@@H](CO)C[C@@H](Nc2ccncn2)[C@H]1F |
| InChI | InChI=1S/C10H13FN3O4P/c11-9-7(14-8-1-2-12-5-13-8)3-6(4-15)10(9)18-19(16)17/h1-2,5-7,9-10,15H,3-4H2,(H-,12,13,14,16,17)/p+1/t6-,7-,9-,10?/m1/s1 |
| InChIKey | IVFYXMWROKRYEM-KETCSUCNSA-O |
| XLogP | 0.64 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|