About N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide
N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide (PubChem CID 174245066) has the molecular formula C7H11N3S3
and a molecular weight of 233.39 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide.
Molecular Properties
| Compound Name | N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide |
| PubChem CID | 174245066 |
| Molecular Formula | C7H11N3S3 |
| Molecular Weight | 233.39 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide |
| SMILES | CC(C)N(C)C=Nc1nc(=S)ss1 |
| InChI | InChI=1S/C7H11N3S3/c1-5(2)10(3)4-8-6-9-7(11)13-12-6/h4-5H,1-3H3 |
| InChIKey | FYAUOEVQYDFNFM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide?
The IUPAC name of N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide (CID 174245066) is N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide.
What is the SMILES notation for N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide?
The canonical SMILES for N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide is CC(C)N(C)C=Nc1nc(=S)ss1.
What is the InChIKey of N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide?
The InChIKey is FYAUOEVQYDFNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S3/c1-5(2)10(3)4-8-6-9-7(11)13-12-6/h4-5H,1-3H3.
What are the key properties of N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide?
N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide has a molecular weight of 233.39 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-propan-2-yl-N'-(5-sulfanylidene-1,2,4-dithiazol-3-yl)methanimidamide is sourced from PubChem (CID 174245066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).