C20H25FN4 — CID 174245262
N-[(3E)-2-aminopenta-1,3-dien-3-yl]-N'-[(1E)-2-fluoro-1-(4-methyl-3a,7a-dihydroindol-1-yl)buta-1,3-dienyl]ethanimidamide (PubChem CID 174245262) has the molecular formula C20H25FN4 and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[(3E)-2-aminopenta-1,3-dien-3-yl]-N'-[(1E)-2-fluoro-1-(4-methyl-3a,7a-dihydroindol-1-yl)buta-1,3-dienyl]ethanimidamide.
| Compound Name | N-[(3E)-2-aminopenta-1,3-dien-3-yl]-N'-[(1E)-2-fluoro-1-(4-methyl-3a,7a-dihydroindol-1-yl)buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 174245262 |
| Molecular Formula | C20H25FN4 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-[(3E)-2-aminopenta-1,3-dien-3-yl]-N'-[(1E)-2-fluoro-1-(4-methyl-3a,7a-dihydroindol-1-yl)buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C/C(F)=C(\N=C(C)N/C(=C/C)C(=C)N)N1C=CC2C(C)=CC=CC21 |
| InChI | InChI=1S/C20H25FN4/c1-6-17(21)20(24-15(5)23-18(7-2)14(4)22)25-12-11-16-13(3)9-8-10-19(16)25/h6-12,16,19H,1,4,22H2,2-3,5H3,(H,23,24)/b18-7+,20-17- |
| InChIKey | UUXZXWFDPXGWEU-NZOBLZJPSA-N |
| XLogP | 4.03 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|