About ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate
ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate (PubChem CID 174245310) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate |
| PubChem CID | 174245310 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate |
| SMILES | CCOC(=O)c1c(O)ccc2c1OCC2 |
| InChI | InChI=1S/C11H12O4/c1-2-14-11(13)9-8(12)4-3-7-5-6-15-10(7)9/h3-4,12H,2,5-6H2,1H3 |
| InChIKey | SQTRHHDEGBKYGG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate?
The IUPAC name of ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate (CID 174245310) is ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate.
What is the SMILES notation for ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate?
The canonical SMILES for ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate is CCOC(=O)c1c(O)ccc2c1OCC2.
What is the InChIKey of ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate?
The InChIKey is SQTRHHDEGBKYGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-2-14-11(13)9-8(12)4-3-7-5-6-15-10(7)9/h3-4,12H,2,5-6H2,1H3.
What are the key properties of ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate?
ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate has a molecular weight of 208.21 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-hydroxy-2,3-dihydro-1-benzofuran-7-carboxylate is sourced from PubChem (CID 174245310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).