C14H15BO5 — CID 174245315
ethyl (10S,12R)-13-hydroxy-4,14-dioxa-13-boratetracyclo[7.5.0.03,7.010,12]tetradeca-1(9),2,7-triene-2-carboxylate (PubChem CID 174245315) has the molecular formula C14H15BO5 and a molecular weight of 274.08 g/mol. Its IUPAC name is ethyl (10S,12R)-13-hydroxy-4,14-dioxa-13-boratetracyclo[7.5.0.03,7.010,12]tetradeca-1(9),2,7-triene-2-carboxylate.
| Compound Name | ethyl (10S,12R)-13-hydroxy-4,14-dioxa-13-boratetracyclo[7.5.0.03,7.010,12]tetradeca-1(9),2,7-triene-2-carboxylate |
|---|---|
| PubChem CID | 174245315 |
| Molecular Formula | C14H15BO5 |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl (10S,12R)-13-hydroxy-4,14-dioxa-13-boratetracyclo[7.5.0.03,7.010,12]tetradeca-1(9),2,7-triene-2-carboxylate |
| SMILES | CCOC(=O)c1c2c(cc3c1OB(O)[C@@H]1C[C@H]31)CCO2 |
| InChI | InChI=1S/C14H15BO5/c1-2-18-14(16)11-12-7(3-4-19-12)5-9-8-6-10(8)15(17)20-13(9)11/h5,8,10,17H,2-4,6H2,1H3/t8-,10-/m1/s1 |
| InChIKey | QRZLAXXOAZXHSW-PSASIEDQSA-N |
| XLogP | 1.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|