C19H26FN3 — CID 174245341
3-[(2Z,5E,7Z)-6-fluoro-3-methyl-9,10-dimethylidene-4H-diazecin-1-yl]-N-methylhepta-1,6-dien-2-amine (PubChem CID 174245341) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-[(2Z,5E,7Z)-6-fluoro-3-methyl-9,10-dimethylidene-4H-diazecin-1-yl]-N-methylhepta-1,6-dien-2-amine.
| Compound Name | 3-[(2Z,5E,7Z)-6-fluoro-3-methyl-9,10-dimethylidene-4H-diazecin-1-yl]-N-methylhepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 174245341 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 3-[(2Z,5E,7Z)-6-fluoro-3-methyl-9,10-dimethylidene-4H-diazecin-1-yl]-N-methylhepta-1,6-dien-2-amine |
| SMILES | C=CCCC(C(=C)NC)N1/N=C(/C)C/C=C(F)\C=C/C(=C)C1=C |
| InChI | InChI=1S/C19H26FN3/c1-7-8-9-19(16(4)21-6)23-17(5)14(2)10-12-18(20)13-11-15(3)22-23/h7,10,12-13,19,21H,1-2,4-5,8-9,11H2,3,6H3/b12-10-,18-13+,22-15- |
| InChIKey | MNBBFUNIOAOKBZ-PUWMCEGVSA-N |
| XLogP | 4.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|