C48H22B9NO — CID 174245382
CID 174245382 (PubChem CID 174245382) has the molecular formula C48H22B9NO and a molecular weight of 726.02 g/mol.
| Compound Name | CID 174245382 |
|---|---|
| PubChem CID | 174245382 |
| Molecular Formula | C48H22B9NO |
| Molecular Weight | 726.02 g/mol |
| Exact Mass | 727.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(c1[B])c([B])c(N(c1cccc(-c3ccc(-c4cccc5c4oc4ccccc45)cc3)c1)c1cccc3ccccc13)c1c([B])c([B])c([B])c([B])c12 |
| InChI | InChI=1S/C48H22B9NO/c49-38-34-35-37(41(52)46(57)44(55)39(35)50)47(42(53)36(34)40(51)45(56)43(38)54)58(32-16-6-9-24-8-1-2-12-28(24)32)27-11-5-10-26(22-27)23-18-20-25(21-19-23)29-14-7-15-31-30-13-3-4-17-33(30)59-48(29)31/h1-22H |
| InChIKey | PWQGZSSSGIVCBE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|