C13H22INO — CID 174245510
2-iodo-N-(2,2,4,4-tetramethylhept-6-ynyl)acetamide (PubChem CID 174245510) has the molecular formula C13H22INO and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-iodo-N-(2,2,4,4-tetramethylhept-6-ynyl)acetamide.
| Compound Name | 2-iodo-N-(2,2,4,4-tetramethylhept-6-ynyl)acetamide |
|---|---|
| PubChem CID | 174245510 |
| Molecular Formula | C13H22INO |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-iodo-N-(2,2,4,4-tetramethylhept-6-ynyl)acetamide |
| SMILES | C#CCC(C)(C)CC(C)(C)CNC(=O)CI |
| InChI | InChI=1S/C13H22INO/c1-6-7-12(2,3)9-13(4,5)10-15-11(16)8-14/h1H,7-10H2,2-5H3,(H,15,16) |
| InChIKey | PVGKPTADLGIONO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|