C18H33N3 — CID 174245731
N-[(1E,4Z,6R)-6-amino-2,5-diethylhepta-1,4-dienyl]-N'-[(Z)-pent-2-enyl]ethanimidamide (PubChem CID 174245731) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N-[(1E,4Z,6R)-6-amino-2,5-diethylhepta-1,4-dienyl]-N'-[(Z)-pent-2-enyl]ethanimidamide.
| Compound Name | N-[(1E,4Z,6R)-6-amino-2,5-diethylhepta-1,4-dienyl]-N'-[(Z)-pent-2-enyl]ethanimidamide |
|---|---|
| PubChem CID | 174245731 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N-[(1E,4Z,6R)-6-amino-2,5-diethylhepta-1,4-dienyl]-N'-[(Z)-pent-2-enyl]ethanimidamide |
| SMILES | CC/C=C\C/N=C(\C)N/C=C(\CC)C/C=C(/CC)[C@@H](C)N |
| InChI | InChI=1S/C18H33N3/c1-6-9-10-13-20-16(5)21-14-17(7-2)11-12-18(8-3)15(4)19/h9-10,12,14-15H,6-8,11,13,19H2,1-5H3,(H,20,21)/b10-9-,17-14+,18-12-/t15-/m1/s1 |
| InChIKey | PPVWPVPQIWIGHU-UCLXXDNJSA-N |
| XLogP | 4.33 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|