C13H16F2O — CID 174245774
(1Z,3Z,7Z)-1,2-difluoro-7-(1-methoxyethenyl)deca-1,3,7,9-tetraene (PubChem CID 174245774) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is (1Z,3Z,7Z)-1,2-difluoro-7-(1-methoxyethenyl)deca-1,3,7,9-tetraene.
| Compound Name | (1Z,3Z,7Z)-1,2-difluoro-7-(1-methoxyethenyl)deca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 174245774 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1Z,3Z,7Z)-1,2-difluoro-7-(1-methoxyethenyl)deca-1,3,7,9-tetraene |
| SMILES | C=C/C=C(/CC/C=C\C(F)=C\F)C(=C)OC |
| InChI | InChI=1S/C13H16F2O/c1-4-7-12(11(2)16-3)8-5-6-9-13(15)10-14/h4,6-7,9-10H,1-2,5,8H2,3H3/b9-6-,12-7-,13-10- |
| InChIKey | JUEBSYBAAHGACF-IYHZJWRCSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|