C46H24B7NO — CID 174246166
CID 174246166 (PubChem CID 174246166) has the molecular formula C46H24B7NO and a molecular weight of 682.39 g/mol.
| Compound Name | CID 174246166 |
|---|---|
| PubChem CID | 174246166 |
| Molecular Formula | C46H24B7NO |
| Molecular Weight | 682.39 g/mol |
| Exact Mass | 683.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc(-c5ccc6oc7ccccc7c6c5)cc4)cc3)c([B])c([B])c([B])c2c1[B] |
| InChI | InChI=1S/C46H24B7NO/c47-39-37-38(41(49)43(51)42(39)50)46(45(53)44(52)40(37)48)54(31-19-14-27(15-20-31)25-6-2-1-3-7-25)32-21-16-28(17-22-32)26-10-12-29(13-11-26)30-18-23-36-34(24-30)33-8-4-5-9-35(33)55-36/h1-24H |
| InChIKey | XXWCCAXGOWFNSC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|