About [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate
[2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate (PubChem CID 174246440) has the molecular formula C13H14F2I2O4
and a molecular weight of 526.06 g/mol. Its IUPAC name is [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate |
| PubChem CID | 174246440 |
| Molecular Formula | C13H14F2I2O4 |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.89 |
| IUPAC Name | [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate |
| SMILES | CCOCOc1c(I)cc(I)cc1COC(=O)C(C)(F)F |
| InChI | InChI=1S/C13H14F2I2O4/c1-3-19-7-21-11-8(4-9(16)5-10(11)17)6-20-12(18)13(2,14)15/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | RHSMMEAQZKUFQC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate?
The IUPAC name of [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate (CID 174246440) is [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate.
What is the SMILES notation for [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate?
The canonical SMILES for [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate is CCOCOc1c(I)cc(I)cc1COC(=O)C(C)(F)F.
What is the InChIKey of [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate?
The InChIKey is RHSMMEAQZKUFQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2I2O4/c1-3-19-7-21-11-8(4-9(16)5-10(11)17)6-20-12(18)13(2,14)15/h4-5H,3,6-7H2,1-2H3.
What are the key properties of [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate?
[2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate has a molecular weight of 526.06 g/mol, XLogP of 3.97, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethoxymethoxy)-3,5-diiodophenyl]methyl 2,2-difluoropropanoate is sourced from PubChem (CID 174246440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).