C15H26N2 — CID 174246586
(5Z,6Z)-5-butan-2-ylidene-3-methanimidoyl-8-methylnona-6,8-dien-2-amine (PubChem CID 174246586) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (5Z,6Z)-5-butan-2-ylidene-3-methanimidoyl-8-methylnona-6,8-dien-2-amine.
| Compound Name | (5Z,6Z)-5-butan-2-ylidene-3-methanimidoyl-8-methylnona-6,8-dien-2-amine |
|---|---|
| PubChem CID | 174246586 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (5Z,6Z)-5-butan-2-ylidene-3-methanimidoyl-8-methylnona-6,8-dien-2-amine |
| SMILES | [H]/N=C/C(CC(/C=C\C(=C)C)=C(\C)CC)C(C)N |
| InChI | InChI=1S/C15H26N2/c1-6-12(4)14(8-7-11(2)3)9-15(10-16)13(5)17/h7-8,10,13,15-16H,2,6,9,17H2,1,3-5H3/b8-7-,14-12+,16-10+ |
| InChIKey | JQCBBATZPKLLIX-RTARCHSFSA-N |
| XLogP | 3.85 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|