About methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate
methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate (PubChem CID 17424702) has the molecular formula C16H15N3O3S
and a molecular weight of 329.38 g/mol. Its IUPAC name is methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate |
| PubChem CID | 17424702 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCc2cc(=O)n3c(C)csc3n2)cc1 |
| InChI | InChI=1S/C16H15N3O3S/c1-10-9-23-16-18-13(7-14(20)19(10)16)8-17-12-5-3-11(4-6-12)15(21)22-2/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | YVIGZCRCFKOYIO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate?
The IUPAC name of methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate (CID 17424702) is methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate.
What is the SMILES notation for methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate?
The canonical SMILES for methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate is COC(=O)c1ccc(NCc2cc(=O)n3c(C)csc3n2)cc1.
What is the InChIKey of methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate?
The InChIKey is YVIGZCRCFKOYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3S/c1-10-9-23-16-18-13(7-14(20)19(10)16)8-17-12-5-3-11(4-6-12)15(21)22-2/h3-7,9,17H,8H2,1-2H3.
What are the key properties of methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate?
methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate has a molecular weight of 329.38 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylamino]benzoate is sourced from PubChem (CID 17424702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).