About 2-butylcyclopentan-1-one;methanamine
2-butylcyclopentan-1-one;methanamine (PubChem CID 174247706) has the molecular formula C12H31N3O
and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-butylcyclopentan-1-one;methanamine.
Molecular Properties
| Compound Name | 2-butylcyclopentan-1-one;methanamine |
| PubChem CID | 174247706 |
| Molecular Formula | C12H31N3O |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.25 |
| IUPAC Name | 2-butylcyclopentan-1-one;methanamine |
| SMILES | CCCCC1CCCC1=O.CN.CN.CN |
| InChI | InChI=1S/C9H16O.3CH5N/c1-2-3-5-8-6-4-7-9(8)10;3*1-2/h8H,2-7H2,1H3;3*2H2,1H3 |
| InChIKey | VLHJFNLHFYVNIF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butylcyclopentan-1-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylcyclopentan-1-one;methanamine?
The IUPAC name of 2-butylcyclopentan-1-one;methanamine (CID 174247706) is 2-butylcyclopentan-1-one;methanamine.
What is the SMILES notation for 2-butylcyclopentan-1-one;methanamine?
The canonical SMILES for 2-butylcyclopentan-1-one;methanamine is CCCCC1CCCC1=O.CN.CN.CN.
What is the InChIKey of 2-butylcyclopentan-1-one;methanamine?
The InChIKey is VLHJFNLHFYVNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O.3CH5N/c1-2-3-5-8-6-4-7-9(8)10;3*1-2/h8H,2-7H2,1H3;3*2H2,1H3.
What are the key properties of 2-butylcyclopentan-1-one;methanamine?
2-butylcyclopentan-1-one;methanamine has a molecular weight of 233.40 g/mol, XLogP of 1.27, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylcyclopentan-1-one;methanamine is sourced from PubChem (CID 174247706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).