About 1-methylpiperidin-4-ol;nitroxyl
1-methylpiperidin-4-ol;nitroxyl (PubChem CID 174247727) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-methylpiperidin-4-ol;nitroxyl.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-ol;nitroxyl |
| PubChem CID | 174247727 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-methylpiperidin-4-ol;nitroxyl |
| SMILES | CN1CCC(O)CC1.N=O |
| InChI | InChI=1S/C6H13NO.HNO/c1-7-4-2-6(8)3-5-7;1-2/h6,8H,2-5H2,1H3;1H |
| InChIKey | LNKIRYWEBMRIPZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpiperidin-4-ol;nitroxyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-ol;nitroxyl?
The IUPAC name of 1-methylpiperidin-4-ol;nitroxyl (CID 174247727) is 1-methylpiperidin-4-ol;nitroxyl.
What is the SMILES notation for 1-methylpiperidin-4-ol;nitroxyl?
The canonical SMILES for 1-methylpiperidin-4-ol;nitroxyl is CN1CCC(O)CC1.N=O.
What is the InChIKey of 1-methylpiperidin-4-ol;nitroxyl?
The InChIKey is LNKIRYWEBMRIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.HNO/c1-7-4-2-6(8)3-5-7;1-2/h6,8H,2-5H2,1H3;1H.
What are the key properties of 1-methylpiperidin-4-ol;nitroxyl?
1-methylpiperidin-4-ol;nitroxyl has a molecular weight of 146.19 g/mol, XLogP of 0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-ol;nitroxyl is sourced from PubChem (CID 174247727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).