About chromium;trimethylsilane
chromium;trimethylsilane (PubChem CID 174247963) has the molecular formula C3H10CrSi
and a molecular weight of 126.19 g/mol. Its IUPAC name is chromium;trimethylsilane.
Molecular Properties
| Compound Name | chromium;trimethylsilane |
| PubChem CID | 174247963 |
| Molecular Formula | C3H10CrSi |
| Molecular Weight | 126.19 g/mol |
| Exact Mass | 126.00 |
| IUPAC Name | chromium;trimethylsilane |
| SMILES | C[SiH](C)C.[Cr] |
| InChI | InChI=1S/C3H10Si.Cr/c1-4(2)3;/h4H,1-3H3; |
| InChIKey | PQWINGLCQXDSJC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chromium;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;trimethylsilane?
The IUPAC name of chromium;trimethylsilane (CID 174247963) is chromium;trimethylsilane.
What is the SMILES notation for chromium;trimethylsilane?
The canonical SMILES for chromium;trimethylsilane is C[SiH](C)C.[Cr].
What is the InChIKey of chromium;trimethylsilane?
The InChIKey is PQWINGLCQXDSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.Cr/c1-4(2)3;/h4H,1-3H3;.
What are the key properties of chromium;trimethylsilane?
chromium;trimethylsilane has a molecular weight of 126.19 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;trimethylsilane is sourced from PubChem (CID 174247963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).