C24H32N2 — CID 174248166
4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene-1,4-diamine (PubChem CID 174248166) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 174248166 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/C)Nc1ccc(NC(/C=C\C)=C/C(=C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32N2/c1-8-11-20(12-9-2)25-21-14-16-22(17-15-21)26-23(13-10-3)18-19(4)24(5,6)7/h8-18,25-26H,1,4H2,2-3,5-7H3/b12-9-,13-10-,20-11+,23-18+ |
| InChIKey | LVGDXYBNQQCKJS-ABHMZBTQSA-N |
| XLogP | 7.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|