About ethane;ethenyl acetate;2-methylbutanoic acid
ethane;ethenyl acetate;2-methylbutanoic acid (PubChem CID 174248174) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is ethane;ethenyl acetate;2-methylbutanoic acid.
Molecular Properties
| Compound Name | ethane;ethenyl acetate;2-methylbutanoic acid |
| PubChem CID | 174248174 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | ethane;ethenyl acetate;2-methylbutanoic acid |
| SMILES | C=COC(C)=O.CC.CCC(C)C(=O)O |
| InChI | InChI=1S/C5H10O2.C4H6O2.C2H6/c1-3-4(2)5(6)7;1-3-6-4(2)5;1-2/h4H,3H2,1-2H3,(H,6,7);3H,1H2,2H3;1-2H3 |
| InChIKey | GHQXZSYKSNRJHW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethenyl acetate;2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethenyl acetate;2-methylbutanoic acid?
The IUPAC name of ethane;ethenyl acetate;2-methylbutanoic acid (CID 174248174) is ethane;ethenyl acetate;2-methylbutanoic acid.
What is the SMILES notation for ethane;ethenyl acetate;2-methylbutanoic acid?
The canonical SMILES for ethane;ethenyl acetate;2-methylbutanoic acid is C=COC(C)=O.CC.CCC(C)C(=O)O.
What is the InChIKey of ethane;ethenyl acetate;2-methylbutanoic acid?
The InChIKey is GHQXZSYKSNRJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H6O2.C2H6/c1-3-4(2)5(6)7;1-3-6-4(2)5;1-2/h4H,3H2,1-2H3,(H,6,7);3H,1H2,2H3;1-2H3.
What are the key properties of ethane;ethenyl acetate;2-methylbutanoic acid?
ethane;ethenyl acetate;2-methylbutanoic acid has a molecular weight of 218.29 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethenyl acetate;2-methylbutanoic acid is sourced from PubChem (CID 174248174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).