About 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate
1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate (PubChem CID 174248249) has the molecular formula C14H18ClNO4
and a molecular weight of 299.75 g/mol. Its IUPAC name is 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate.
Molecular Properties
| Compound Name | 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate |
| PubChem CID | 174248249 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate |
| SMILES | COC(=O)C(CC(N)c1ccccc1)C(=O)OCCCl |
| InChI | InChI=1S/C14H18ClNO4/c1-19-13(17)11(14(18)20-8-7-15)9-12(16)10-5-3-2-4-6-10/h2-6,11-12H,7-9,16H2,1H3 |
| InChIKey | PQOTXBBRPPJIKK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate?
The IUPAC name of 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate (CID 174248249) is 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate.
What is the SMILES notation for 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate?
The canonical SMILES for 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate is COC(=O)C(CC(N)c1ccccc1)C(=O)OCCCl.
What is the InChIKey of 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate?
The InChIKey is PQOTXBBRPPJIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO4/c1-19-13(17)11(14(18)20-8-7-15)9-12(16)10-5-3-2-4-6-10/h2-6,11-12H,7-9,16H2,1H3.
What are the key properties of 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate?
1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate has a molecular weight of 299.75 g/mol, XLogP of 1.65, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-chloroethyl) 3-O-methyl 2-(2-amino-2-phenylethyl)propanedioate is sourced from PubChem (CID 174248249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).