About propan-2-olate;titanium(4+);triiodide
propan-2-olate;titanium(4+);triiodide (PubChem CID 174248492) has the molecular formula C3H7I3OTi
and a molecular weight of 487.67 g/mol. Its IUPAC name is propan-2-olate;titanium(4+);triiodide.
Molecular Properties
| Compound Name | propan-2-olate;titanium(4+);triiodide |
| PubChem CID | 174248492 |
| Molecular Formula | C3H7I3OTi |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.71 |
| IUPAC Name | propan-2-olate;titanium(4+);triiodide |
| SMILES | CC(C)[O-].[I-].[I-].[I-].[Ti+4] |
| InChI | InChI=1S/C3H7O.3HI.Ti/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | MJAANYBZHGEMLW-UHFFFAOYSA-K |
| XLogP | -9.24 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | -9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propan-2-olate;titanium(4+);triiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-olate;titanium(4+);triiodide?
The IUPAC name of propan-2-olate;titanium(4+);triiodide (CID 174248492) is propan-2-olate;titanium(4+);triiodide.
What is the SMILES notation for propan-2-olate;titanium(4+);triiodide?
The canonical SMILES for propan-2-olate;titanium(4+);triiodide is CC(C)[O-].[I-].[I-].[I-].[Ti+4].
What is the InChIKey of propan-2-olate;titanium(4+);triiodide?
The InChIKey is MJAANYBZHGEMLW-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7O.3HI.Ti/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of propan-2-olate;titanium(4+);triiodide?
propan-2-olate;titanium(4+);triiodide has a molecular weight of 487.67 g/mol, XLogP of -9.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-olate;titanium(4+);triiodide is sourced from PubChem (CID 174248492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).