About 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one
4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one (PubChem CID 174250176) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one.
Molecular Properties
| Compound Name | 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one |
| PubChem CID | 174250176 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one |
| SMILES | C=CCC1CCC(=O)O1.Nc1co[nH]c1=O |
| InChI | InChI=1S/C7H10O2.C3H4N2O2/c1-2-3-6-4-5-7(8)9-6;4-2-1-7-5-3(2)6/h2,6H,1,3-5H2;1H,4H2,(H,5,6) |
| InChIKey | JPURLFSEKLPSIK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one?
The IUPAC name of 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one (CID 174250176) is 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one.
What is the SMILES notation for 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one?
The canonical SMILES for 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one is C=CCC1CCC(=O)O1.Nc1co[nH]c1=O.
What is the InChIKey of 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one?
The InChIKey is JPURLFSEKLPSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.C3H4N2O2/c1-2-3-6-4-5-7(8)9-6;4-2-1-7-5-3(2)6/h2,6H,1,3-5H2;1H,4H2,(H,5,6).
What are the key properties of 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one?
4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one has a molecular weight of 226.23 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2-oxazol-3-one;5-prop-2-enyloxolan-2-one is sourced from PubChem (CID 174250176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).