About 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide
3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide (PubChem CID 174250450) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide |
| PubChem CID | 174250450 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide |
| SMILES | NCCN1C=CSC1C(N)=O |
| InChI | InChI=1S/C6H11N3OS/c7-1-2-9-3-4-11-6(9)5(8)10/h3-4,6H,1-2,7H2,(H2,8,10) |
| InChIKey | IZYPRCJKOJUZRF-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide?
The IUPAC name of 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide (CID 174250450) is 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide?
The canonical SMILES for 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide is NCCN1C=CSC1C(N)=O.
What is the InChIKey of 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide?
The InChIKey is IZYPRCJKOJUZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c7-1-2-9-3-4-11-6(9)5(8)10/h3-4,6H,1-2,7H2,(H2,8,10).
What are the key properties of 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide?
3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide has a molecular weight of 173.24 g/mol, XLogP of -0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-2H-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 174250450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).