About 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone
2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone (PubChem CID 174250468) has the molecular formula C17H22Cl2N2OS
and a molecular weight of 373.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone |
| PubChem CID | 174250468 |
| Molecular Formula | C17H22Cl2N2OS |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone |
| SMILES | [H]/N=C(\CCC)CC1CSCCN1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2N2OS/c1-2-3-13(20)10-14-11-23-7-6-21(14)17(22)9-12-4-5-15(18)16(19)8-12/h4-5,8,14,20H,2-3,6-7,9-11H2,1H3/b20-13+ |
| InChIKey | NCZFMURBKNECOZ-DEDYPNTBSA-N |
| XLogP | 4.69 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone?
The IUPAC name of 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone (CID 174250468) is 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone?
The canonical SMILES for 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone is [H]/N=C(\CCC)CC1CSCCN1C(=O)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone?
The InChIKey is NCZFMURBKNECOZ-DEDYPNTBSA-N. The full InChI is InChI=1S/C17H22Cl2N2OS/c1-2-3-13(20)10-14-11-23-7-6-21(14)17(22)9-12-4-5-15(18)16(19)8-12/h4-5,8,14,20H,2-3,6-7,9-11H2,1H3/b20-13+.
What are the key properties of 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone?
2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone has a molecular weight of 373.35 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone is sourced from PubChem (CID 174250468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).