C63H118O12 — CID 174250478
2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl (Z)-octadec-9-enoate;hexane-1,2,3,4,5,6-hexol (PubChem CID 174250478) has the molecular formula C63H118O12 and a molecular weight of 1067.62 g/mol. Its IUPAC name is 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl (Z)-octadec-9-enoate;hexane-1,2,3,4,5,6-hexol.
| Compound Name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl (Z)-octadec-9-enoate;hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 174250478 |
| Molecular Formula | C63H118O12 |
| Molecular Weight | 1067.62 g/mol |
| Exact Mass | 1066.86 |
| IUPAC Name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl (Z)-octadec-9-enoate;hexane-1,2,3,4,5,6-hexol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C57H104O6.C6H14O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2;7-1-3(9)5(11)6(12)4(10)2-8/h25-30,54H,4-24,31-53H2,1-3H3;3-12H,1-2H2/b28-25-,29-26-,30-27-; |
| InChIKey | VASYDMQYDVAIRB-PXDFOQPKSA-N |
| XLogP | 14.51 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 75 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.62 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|