C9H17N3O2S — CID 174250562
[2-(1-ethanimidoylpyrrolidin-3-yl)-2-sulfanylethyl]carbamic acid (PubChem CID 174250562) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is [2-(1-ethanimidoylpyrrolidin-3-yl)-2-sulfanylethyl]carbamic acid.
| Compound Name | [2-(1-ethanimidoylpyrrolidin-3-yl)-2-sulfanylethyl]carbamic acid |
|---|---|
| PubChem CID | 174250562 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | [2-(1-ethanimidoylpyrrolidin-3-yl)-2-sulfanylethyl]carbamic acid |
| SMILES | [H]/N=C(\C)N1CCC(C(S)CNC(=O)O)C1 |
| InChI | InChI=1S/C9H17N3O2S/c1-6(10)12-3-2-7(5-12)8(15)4-11-9(13)14/h7-8,10-11,15H,2-5H2,1H3,(H,13,14)/b10-6+ |
| InChIKey | BFZISFNSHDKWRF-UXBLZVDNSA-N |
| XLogP | 0.87 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|