About 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine
2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine (PubChem CID 174250812) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine |
| PubChem CID | 174250812 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine |
| SMILES | C=CCC1=C(C2OCCO2)OC=CO1 |
| InChI | InChI=1S/C10H12O4/c1-2-3-8-9(12-5-4-11-8)10-13-6-7-14-10/h2,4-5,10H,1,3,6-7H2 |
| InChIKey | NANMBHOZKAGXLF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine?
The IUPAC name of 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine (CID 174250812) is 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine is C=CCC1=C(C2OCCO2)OC=CO1.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine?
The InChIKey is NANMBHOZKAGXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-2-3-8-9(12-5-4-11-8)10-13-6-7-14-10/h2,4-5,10H,1,3,6-7H2.
What are the key properties of 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine?
2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine has a molecular weight of 196.20 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)-3-prop-2-enyl-1,4-dioxine is sourced from PubChem (CID 174250812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).