C15H22N2OS2 — CID 174251090
1-[(3R)-3-(2-iminopentyl)thiomorpholin-4-yl]-2-thiophen-2-ylethanone (PubChem CID 174251090) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-[(3R)-3-(2-iminopentyl)thiomorpholin-4-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(3R)-3-(2-iminopentyl)thiomorpholin-4-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 174251090 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[(3R)-3-(2-iminopentyl)thiomorpholin-4-yl]-2-thiophen-2-ylethanone |
| SMILES | [H]/N=C(\CCC)C[C@@H]1CSCCN1C(=O)Cc1cccs1 |
| InChI | InChI=1S/C15H22N2OS2/c1-2-4-12(16)9-13-11-19-8-6-17(13)15(18)10-14-5-3-7-20-14/h3,5,7,13,16H,2,4,6,8-11H2,1H3/b16-12+/t13-/m1/s1 |
| InChIKey | PENHURRMLMYILX-MLDYKZIASA-N |
| XLogP | 3.44 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|