About 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol
1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol (PubChem CID 174251383) has the molecular formula C4H8N4S2
and a molecular weight of 176.27 g/mol. Its IUPAC name is 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol.
Molecular Properties
| Compound Name | 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol |
| PubChem CID | 174251383 |
| Molecular Formula | C4H8N4S2 |
| Molecular Weight | 176.27 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol |
| SMILES | Cn1nnnc1C(S)CS |
| InChI | InChI=1S/C4H8N4S2/c1-8-4(3(10)2-9)5-6-7-8/h3,9-10H,2H2,1H3 |
| InChIKey | YEOCPWVHAIWJOL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 43.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol?
The IUPAC name of 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol (CID 174251383) is 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol.
What is the SMILES notation for 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol?
The canonical SMILES for 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol is Cn1nnnc1C(S)CS.
What is the InChIKey of 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol?
The InChIKey is YEOCPWVHAIWJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4S2/c1-8-4(3(10)2-9)5-6-7-8/h3,9-10H,2H2,1H3.
What are the key properties of 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol?
1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol has a molecular weight of 176.27 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyltetrazol-5-yl)ethane-1,2-dithiol is sourced from PubChem (CID 174251383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).